C25H28F2N5O+ — CID 166890009
[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]methyl-trimethylazanium (PubChem CID 166890009) has the molecular formula C25H28F2N5O+ and a molecular weight of 452.53 g/mol. Its IUPAC name is [4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]methyl-trimethylazanium.
| Compound Name | [4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]methyl-trimethylazanium |
|---|---|
| PubChem CID | 166890009 |
| Molecular Formula | C25H28F2N5O+ |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.23 |
| IUPAC Name | [4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]methyl-trimethylazanium |
| SMILES | CCc1cc(Nc2nccn3c(-c4ccc(OC)c(F)c4F)cnc23)ccc1C[N+](C)(C)C |
| InChI | InChI=1S/C25H28F2N5O/c1-6-16-13-18(8-7-17(16)15-32(2,3)4)30-24-25-29-14-20(31(25)12-11-28-24)19-9-10-21(33-5)23(27)22(19)26/h7-14H,6,15H2,1-5H3,(H,28,30)/q+1 |
| InChIKey | JKKAYPNPUJSPDR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 51.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|