C30H36F2N7O2S+ — CID 166890010
[2-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]sulfanylpiperazin-1-yl]-2-oxoethyl]-trimethylazanium (PubChem CID 166890010) has the molecular formula C30H36F2N7O2S+ and a molecular weight of 596.73 g/mol. Its IUPAC name is [2-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]sulfanylpiperazin-1-yl]-2-oxoethyl]-trimethylazanium.
| Compound Name | [2-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]sulfanylpiperazin-1-yl]-2-oxoethyl]-trimethylazanium |
|---|---|
| PubChem CID | 166890010 |
| Molecular Formula | C30H36F2N7O2S+ |
| Molecular Weight | 596.73 g/mol |
| Exact Mass | 596.26 |
| IUPAC Name | [2-[4-[4-[[3-(2,3-difluoro-4-methoxyphenyl)imidazo[1,2-a]pyrazin-8-yl]amino]-2-ethylphenyl]sulfanylpiperazin-1-yl]-2-oxoethyl]-trimethylazanium |
| SMILES | CCc1cc(Nc2nccn3c(-c4ccc(OC)c(F)c4F)cnc23)ccc1SN1CCN(C(=O)C[N+](C)(C)C)CC1 |
| InChI | InChI=1S/C30H36F2N7O2S/c1-6-20-17-21(7-10-25(20)42-37-15-13-36(14-16-37)26(40)19-39(2,3)4)35-29-30-34-18-23(38(30)12-11-33-29)22-8-9-24(41-5)28(32)27(22)31/h7-12,17-18H,6,13-16,19H2,1-5H3,(H,33,35)/q+1 |
| InChIKey | QAEVUAMDFKXNEM-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 75.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.73 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|