C8H8N4 — CID 166898197
3,8-dimethylpyridazino[3,4-d]pyridazine (PubChem CID 166898197) has the molecular formula C8H8N4 and a molecular weight of 160.18 g/mol. Its IUPAC name is 3,8-dimethylpyridazino[3,4-d]pyridazine.
| Compound Name | 3,8-dimethylpyridazino[3,4-d]pyridazine |
|---|---|
| PubChem CID | 166898197 |
| Molecular Formula | C8H8N4 |
| Molecular Weight | 160.18 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 3,8-dimethylpyridazino[3,4-d]pyridazine |
| SMILES | Cc1cc2cnnc(C)c2nn1 |
| InChI | InChI=1S/C8H8N4/c1-5-3-7-4-9-11-6(2)8(7)12-10-5/h3-4H,1-2H3 |
| InChIKey | ZSXPHTIMROOKOY-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.18 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |