About 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene
2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene (PubChem CID 166898375) has the molecular formula C9H9F3
and a molecular weight of 174.16 g/mol. Its IUPAC name is 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene.
Analyze 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene?
The IUPAC name of 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene (CID 166898375) is 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene.
What is the SMILES notation for 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene?
The canonical SMILES for 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene is Cc1cccc(F)c1CC(F)F.
What is the InChIKey of 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene?
The InChIKey is GFQKCPQEQHUBGU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9F3/c1-6-3-2-4-8(10)7(6)5-9(11)12/h2-4,9H,5H2,1H3.
What are the key properties of 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene?
2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene has a molecular weight of 174.16 g/mol, XLogP of 2.94, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-difluoroethyl)-1-fluoro-3-methylbenzene is sourced from PubChem (CID 166898375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).