About 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol
3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol (PubChem CID 112575476) has the molecular formula C11H14F2O
and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol |
| PubChem CID | 112575476 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol |
| SMILES | Cc1cccc(C)c1CC(O)C(F)F |
| InChI | InChI=1S/C11H14F2O/c1-7-4-3-5-8(2)9(7)6-10(14)11(12)13/h3-5,10-11,14H,6H2,1-2H3 |
| InChIKey | ZRDDJGALQTYGNN-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol?
The IUPAC name of 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol (CID 112575476) is 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol is Cc1cccc(C)c1CC(O)C(F)F.
What is the InChIKey of 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol?
The InChIKey is ZRDDJGALQTYGNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O/c1-7-4-3-5-8(2)9(7)6-10(14)11(12)13/h3-5,10-11,14H,6H2,1-2H3.
What are the key properties of 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol?
3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol has a molecular weight of 200.23 g/mol, XLogP of 2.47, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,6-dimethylphenyl)-1,1-difluoropropan-2-ol is sourced from PubChem (CID 112575476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).