About 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol
3-(4-ethylphenyl)-1,1-difluoropropan-2-ol (PubChem CID 112575617) has the molecular formula C11H14F2O
and a molecular weight of 200.23 g/mol. Its IUPAC name is 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol.
Molecular Properties
| Compound Name | 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol |
| PubChem CID | 112575617 |
| Molecular Formula | C11H14F2O |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol |
| SMILES | CCc1ccc(CC(O)C(F)F)cc1 |
| InChI | InChI=1S/C11H14F2O/c1-2-8-3-5-9(6-4-8)7-10(14)11(12)13/h3-6,10-11,14H,2,7H2,1H3 |
| InChIKey | UKDAXKKJPFBKKW-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol?
The IUPAC name of 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol (CID 112575617) is 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol.
What is the SMILES notation for 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol?
The canonical SMILES for 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol is CCc1ccc(CC(O)C(F)F)cc1.
What is the InChIKey of 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol?
The InChIKey is UKDAXKKJPFBKKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14F2O/c1-2-8-3-5-9(6-4-8)7-10(14)11(12)13/h3-6,10-11,14H,2,7H2,1H3.
What are the key properties of 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol?
3-(4-ethylphenyl)-1,1-difluoropropan-2-ol has a molecular weight of 200.23 g/mol, XLogP of 2.42, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-ethylphenyl)-1,1-difluoropropan-2-ol is sourced from PubChem (CID 112575617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).