C22H33N5O3S — CID 166904541
8-cyclopentyl-2-[[1-(3-methylbut-2-enylsulfonyl)piperidin-4-yl]amino]-7H-pyrido[2,3-d]pyrimidin-7-ol (PubChem CID 166904541) has the molecular formula C22H33N5O3S and a molecular weight of 447.61 g/mol. Its IUPAC name is 8-cyclopentyl-2-[[1-(3-methylbut-2-enylsulfonyl)piperidin-4-yl]amino]-7H-pyrido[2,3-d]pyrimidin-7-ol.
| Compound Name | 8-cyclopentyl-2-[[1-(3-methylbut-2-enylsulfonyl)piperidin-4-yl]amino]-7H-pyrido[2,3-d]pyrimidin-7-ol |
|---|---|
| PubChem CID | 166904541 |
| Molecular Formula | C22H33N5O3S |
| Molecular Weight | 447.61 g/mol |
| Exact Mass | 447.23 |
| IUPAC Name | 8-cyclopentyl-2-[[1-(3-methylbut-2-enylsulfonyl)piperidin-4-yl]amino]-7H-pyrido[2,3-d]pyrimidin-7-ol |
| SMILES | CC(C)=CCS(=O)(=O)N1CCC(Nc2ncc3c(n2)N(C2CCCC2)C(O)C=C3)CC1 |
| InChI | InChI=1S/C22H33N5O3S/c1-16(2)11-14-31(29,30)26-12-9-18(10-13-26)24-22-23-15-17-7-8-20(28)27(21(17)25-22)19-5-3-4-6-19/h7-8,11,15,18-20,28H,3-6,9-10,12-14H2,1-2H3,(H,23,24,25) |
| InChIKey | VFEUZTVOLXZUFV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.61 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|