C16H36O11P2 — CID 166907584
ethyl-[2-hydroxy-3-[2-[2-[2-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]propoxy]phosphinic acid (PubChem CID 166907584) has the molecular formula C16H36O11P2 and a molecular weight of 466.40 g/mol. Its IUPAC name is ethyl-[2-hydroxy-3-[2-[2-[2-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]propoxy]phosphinic acid.
| Compound Name | ethyl-[2-hydroxy-3-[2-[2-[2-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]propoxy]phosphinic acid |
|---|---|
| PubChem CID | 166907584 |
| Molecular Formula | C16H36O11P2 |
| Molecular Weight | 466.40 g/mol |
| Exact Mass | 466.17 |
| IUPAC Name | ethyl-[2-hydroxy-3-[2-[2-[2-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethoxy]ethoxy]ethoxy]ethoxy]propoxy]phosphinic acid |
| SMILES | CCP(=O)(O)OCC(O)COCCOCCOCCOCCOP(=O)(O)C(C)C |
| InChI | InChI=1S/C16H36O11P2/c1-4-28(18,19)27-14-16(17)13-25-10-9-23-6-5-22-7-8-24-11-12-26-29(20,21)15(2)3/h15-17H,4-14H2,1-3H3,(H,18,19)(H,20,21) |
| InChIKey | GPKPLHLNQWRUGF-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 150.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.40 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|