C11H27NO6P+ — CID 149237603
tris(2-hydroxyethyl)-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethyl]azanium (PubChem CID 149237603) has the molecular formula C11H27NO6P+ and a molecular weight of 300.31 g/mol. Its IUPAC name is tris(2-hydroxyethyl)-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethyl]azanium.
| Compound Name | tris(2-hydroxyethyl)-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethyl]azanium |
|---|---|
| PubChem CID | 149237603 |
| Molecular Formula | C11H27NO6P+ |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | tris(2-hydroxyethyl)-[2-[hydroxy(propan-2-yl)phosphoryl]oxyethyl]azanium |
| SMILES | CC(C)P(=O)(O)OCC[N+](CCO)(CCO)CCO |
| InChI | InChI=1S/C11H26NO6P/c1-11(2)19(16,17)18-10-6-12(3-7-13,4-8-14)5-9-15/h11,13-15H,3-10H2,1-2H3/p+1 |
| InChIKey | XLNMOTFYRDLBQB-UHFFFAOYSA-O |
| XLogP | -0.61 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|