C16H36O10P2 — CID 156663536
3-[2-(hydroxymethyl)-3-[3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropoxy]propoxy]propoxy-propan-2-ylphosphinic acid (PubChem CID 156663536) has the molecular formula C16H36O10P2 and a molecular weight of 450.40 g/mol. Its IUPAC name is 3-[2-(hydroxymethyl)-3-[3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropoxy]propoxy]propoxy-propan-2-ylphosphinic acid.
| Compound Name | 3-[2-(hydroxymethyl)-3-[3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropoxy]propoxy]propoxy-propan-2-ylphosphinic acid |
|---|---|
| PubChem CID | 156663536 |
| Molecular Formula | C16H36O10P2 |
| Molecular Weight | 450.40 g/mol |
| Exact Mass | 450.18 |
| IUPAC Name | 3-[2-(hydroxymethyl)-3-[3-[hydroxy(propan-2-yloxy)phosphoryl]oxypropoxy]propoxy]propoxy-propan-2-ylphosphinic acid |
| SMILES | CC(C)OP(=O)(O)OCCCOCC(CO)COCCCOP(=O)(O)C(C)C |
| InChI | InChI=1S/C16H36O10P2/c1-14(2)26-28(20,21)25-10-6-8-23-13-16(11-17)12-22-7-5-9-24-27(18,19)15(3)4/h14-17H,5-13H2,1-4H3,(H,18,19)(H,20,21) |
| InChIKey | YLSOOYRJPAZBAT-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 140.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.40 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|