C33H40N4O3S2 — CID 166912760
4-[4-(4-cyclobutylcyclohexyl)piperazin-1-yl]-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide (PubChem CID 166912760) has the molecular formula C33H40N4O3S2 and a molecular weight of 604.84 g/mol. Its IUPAC name is 4-[4-(4-cyclobutylcyclohexyl)piperazin-1-yl]-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-[4-(4-cyclobutylcyclohexyl)piperazin-1-yl]-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 166912760 |
| Molecular Formula | C33H40N4O3S2 |
| Molecular Weight | 604.84 g/mol |
| Exact Mass | 604.25 |
| IUPAC Name | 4-[4-(4-cyclobutylcyclohexyl)piperazin-1-yl]-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1cc(C)c(Sc2cnc(NC(=O)c3ccc(N4CCN(C5CCC(C6CCC6)CC5)CC4)cc3)s2)cc1C=O |
| InChI | InChI=1S/C33H40N4O3S2/c1-22-18-29(40-2)26(21-38)19-30(22)41-31-20-34-33(42-31)35-32(39)25-8-12-28(13-9-25)37-16-14-36(15-17-37)27-10-6-24(7-11-27)23-4-3-5-23/h8-9,12-13,18-21,23-24,27H,3-7,10-11,14-17H2,1-2H3,(H,34,35,39) |
| InChIKey | OEJFSVGGJWNZNX-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 74.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.84 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|