C29H32N2O4S2 — CID 166912853
4-(4-cyclobutylcyclohexyl)oxy-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide (PubChem CID 166912853) has the molecular formula C29H32N2O4S2 and a molecular weight of 536.72 g/mol. Its IUPAC name is 4-(4-cyclobutylcyclohexyl)oxy-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(4-cyclobutylcyclohexyl)oxy-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 166912853 |
| Molecular Formula | C29H32N2O4S2 |
| Molecular Weight | 536.72 g/mol |
| Exact Mass | 536.18 |
| IUPAC Name | 4-(4-cyclobutylcyclohexyl)oxy-N-[5-(5-formyl-4-methoxy-2-methylphenyl)sulfanyl-1,3-thiazol-2-yl]benzamide |
| SMILES | COc1cc(C)c(Sc2cnc(NC(=O)c3ccc(OC4CCC(C5CCC5)CC4)cc3)s2)cc1C=O |
| InChI | InChI=1S/C29H32N2O4S2/c1-18-14-25(34-2)22(17-32)15-26(18)36-27-16-30-29(37-27)31-28(33)21-8-12-24(13-9-21)35-23-10-6-20(7-11-23)19-4-3-5-19/h8-9,12-17,19-20,23H,3-7,10-11H2,1-2H3,(H,30,31,33) |
| InChIKey | JYEWINQWIUIJPB-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.72 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|