C28H24FN7S — CID 166917430
5-[3-benzyl-1-(2-methyltriazol-4-yl)sulfanylpyrrolidin-3-yl]-1-(4-fluorophenyl)indazole-6-carbonitrile (PubChem CID 166917430) has the molecular formula C28H24FN7S and a molecular weight of 509.61 g/mol. Its IUPAC name is 5-[3-benzyl-1-(2-methyltriazol-4-yl)sulfanylpyrrolidin-3-yl]-1-(4-fluorophenyl)indazole-6-carbonitrile.
| Compound Name | 5-[3-benzyl-1-(2-methyltriazol-4-yl)sulfanylpyrrolidin-3-yl]-1-(4-fluorophenyl)indazole-6-carbonitrile |
|---|---|
| PubChem CID | 166917430 |
| Molecular Formula | C28H24FN7S |
| Molecular Weight | 509.61 g/mol |
| Exact Mass | 509.18 |
| IUPAC Name | 5-[3-benzyl-1-(2-methyltriazol-4-yl)sulfanylpyrrolidin-3-yl]-1-(4-fluorophenyl)indazole-6-carbonitrile |
| SMILES | Cn1ncc(SN2CCC(Cc3ccccc3)(c3cc4cnn(-c5ccc(F)cc5)c4cc3C#N)C2)n1 |
| InChI | InChI=1S/C28H24FN7S/c1-34-31-18-27(33-34)37-35-12-11-28(19-35,15-20-5-3-2-4-6-20)25-13-22-17-32-36(26(22)14-21(25)16-30)24-9-7-23(29)8-10-24/h2-10,13-14,17-18H,11-12,15,19H2,1H3 |
| InChIKey | NXCGRCCYAMRAAO-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 75.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.61 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|