C13H14N2 — CID 166917654
5-pyridin-3-yl-3-azatricyclo[5.2.0.01,4]non-8-ene (PubChem CID 166917654) has the molecular formula C13H14N2 and a molecular weight of 198.27 g/mol. Its IUPAC name is 5-pyridin-3-yl-3-azatricyclo[5.2.0.01,4]non-8-ene.
| Compound Name | 5-pyridin-3-yl-3-azatricyclo[5.2.0.01,4]non-8-ene |
|---|---|
| PubChem CID | 166917654 |
| Molecular Formula | C13H14N2 |
| Molecular Weight | 198.27 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | 5-pyridin-3-yl-3-azatricyclo[5.2.0.01,4]non-8-ene |
| SMILES | C1=CC23CNC2C(c2cccnc2)CC13 |
| InChI | InChI=1S/C13H14N2/c1-2-9(7-14-5-1)11-6-10-3-4-13(10)8-15-12(11)13/h1-5,7,10-12,15H,6,8H2 |
| InChIKey | FJPZMSCIGWORLM-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|