C15H26N2S — CID 166917905
N-[(E)-4-(pentamethyl-λ6-sulfanyl)but-3-enyl]-1-pyridin-3-ylmethanimine (PubChem CID 166917905) has the molecular formula C15H26N2S and a molecular weight of 266.45 g/mol. Its IUPAC name is N-[(E)-4-(pentamethyl-λ6-sulfanyl)but-3-enyl]-1-pyridin-3-ylmethanimine.
| Compound Name | N-[(E)-4-(pentamethyl-λ6-sulfanyl)but-3-enyl]-1-pyridin-3-ylmethanimine |
|---|---|
| PubChem CID | 166917905 |
| Molecular Formula | C15H26N2S |
| Molecular Weight | 266.45 g/mol |
| Exact Mass | 266.18 |
| IUPAC Name | N-[(E)-4-(pentamethyl-λ6-sulfanyl)but-3-enyl]-1-pyridin-3-ylmethanimine |
| SMILES | CS(C)(C)(C)(C)/C=C/CC/N=C/c1cccnc1 |
| InChI | InChI=1S/C15H26N2S/c1-18(2,3,4,5)12-7-6-10-16-13-15-9-8-11-17-14-15/h7-9,11-14H,6,10H2,1-5H3/b12-7+,16-13+ |
| InChIKey | ATMSXFPXOQYQTO-WTHIONNESA-N |
| XLogP | 3.43 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|