C24H27N7 — CID 69234303
2-(pyridin-3-ylmethylideneamino)-N,N-bis[2-(pyridin-3-ylmethylideneamino)ethyl]ethanamine (PubChem CID 69234303) has the molecular formula C24H27N7 and a molecular weight of 413.53 g/mol. Its IUPAC name is 2-(pyridin-3-ylmethylideneamino)-N,N-bis[2-(pyridin-3-ylmethylideneamino)ethyl]ethanamine.
| Compound Name | 2-(pyridin-3-ylmethylideneamino)-N,N-bis[2-(pyridin-3-ylmethylideneamino)ethyl]ethanamine |
|---|---|
| PubChem CID | 69234303 |
| Molecular Formula | C24H27N7 |
| Molecular Weight | 413.53 g/mol |
| Exact Mass | 413.23 |
| IUPAC Name | 2-(pyridin-3-ylmethylideneamino)-N,N-bis[2-(pyridin-3-ylmethylideneamino)ethyl]ethanamine |
| SMILES | C(=N/CCN(CC/N=C/c1cccnc1)CC/N=C/c1cccnc1)\c1cccnc1 |
| InChI | InChI=1S/C24H27N7/c1-4-22(16-25-7-1)19-28-10-13-31(14-11-29-20-23-5-2-8-26-17-23)15-12-30-21-24-6-3-9-27-18-24/h1-9,16-21H,10-15H2/b28-19+,29-20+,30-21+ |
| InChIKey | BPALUMBQFMKZKM-YILJOUTGSA-N |
| XLogP | 2.83 |
| TPSA | 78.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.53 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|