C28H34F3N3O6 — CID 166922114
(2,2,3-trimethyl-8-tricyclo[4.2.0.01,3]octanyl) 1-[3,3,3-trifluoro-2-[[2-hydroxy-3-(4-nitrosophenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carboxylate (PubChem CID 166922114) has the molecular formula C28H34F3N3O6 and a molecular weight of 565.59 g/mol. Its IUPAC name is (2,2,3-trimethyl-8-tricyclo[4.2.0.01,3]octanyl) 1-[3,3,3-trifluoro-2-[[2-hydroxy-3-(4-nitrosophenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carboxylate.
| Compound Name | (2,2,3-trimethyl-8-tricyclo[4.2.0.01,3]octanyl) 1-[3,3,3-trifluoro-2-[[2-hydroxy-3-(4-nitrosophenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 166922114 |
| Molecular Formula | C28H34F3N3O6 |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 565.24 |
| IUPAC Name | (2,2,3-trimethyl-8-tricyclo[4.2.0.01,3]octanyl) 1-[3,3,3-trifluoro-2-[[2-hydroxy-3-(4-nitrosophenyl)propanoyl]amino]propanoyl]pyrrolidine-2-carboxylate |
| SMILES | CC1(C)C2(C)CCC3CC(OC(=O)C4CCCN4C(=O)C(NC(=O)C(O)Cc4ccc(N=O)cc4)C(F)(F)F)C312 |
| InChI | InChI=1S/C28H34F3N3O6/c1-25(2)26(3)11-10-16-14-20(27(16,25)26)40-24(38)18-5-4-12-34(18)23(37)21(28(29,30)31)32-22(36)19(35)13-15-6-8-17(33-39)9-7-15/h6-9,16,18-21,35H,4-5,10-14H2,1-3H3,(H,32,36) |
| InChIKey | AAYHHSANDRRCLQ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 125.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |