C8H14FN — CID 166923894
(3E)-N-ethyl-5-fluorohexa-3,5-dien-3-amine (PubChem CID 166923894) has the molecular formula C8H14FN and a molecular weight of 143.20 g/mol. Its IUPAC name is (3E)-N-ethyl-5-fluorohexa-3,5-dien-3-amine.
| Compound Name | (3E)-N-ethyl-5-fluorohexa-3,5-dien-3-amine |
|---|---|
| PubChem CID | 166923894 |
| Molecular Formula | C8H14FN |
| Molecular Weight | 143.20 g/mol |
| Exact Mass | 143.11 |
| IUPAC Name | (3E)-N-ethyl-5-fluorohexa-3,5-dien-3-amine |
| SMILES | C=C(F)/C=C(\CC)NCC |
| InChI | InChI=1S/C8H14FN/c1-4-8(10-5-2)6-7(3)9/h6,10H,3-5H2,1-2H3/b8-6+ |
| InChIKey | HIXPAYSNBWJETN-SOFGYWHQSA-N |
| XLogP | 2.37 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 143.20 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|