C14H28FNO — CID 166927362
N-fluoro-2,3,3,6-tetramethyl-N-propan-2-ylheptanamide (PubChem CID 166927362) has the molecular formula C14H28FNO and a molecular weight of 245.38 g/mol. Its IUPAC name is N-fluoro-2,3,3,6-tetramethyl-N-propan-2-ylheptanamide.
| Compound Name | N-fluoro-2,3,3,6-tetramethyl-N-propan-2-ylheptanamide |
|---|---|
| PubChem CID | 166927362 |
| Molecular Formula | C14H28FNO |
| Molecular Weight | 245.38 g/mol |
| Exact Mass | 245.22 |
| IUPAC Name | N-fluoro-2,3,3,6-tetramethyl-N-propan-2-ylheptanamide |
| SMILES | CC(C)CCC(C)(C)C(C)C(=O)N(F)C(C)C |
| InChI | InChI=1S/C14H28FNO/c1-10(2)8-9-14(6,7)12(5)13(17)16(15)11(3)4/h10-12H,8-9H2,1-7H3 |
| InChIKey | XBTASNDHJSUZPW-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.38 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|