C20H38CoO4 — CID 22833328
cobalt(2+);bis(2-ethyl-2,5-dimethylhexanoate) (PubChem CID 22833328) has the molecular formula C20H38CoO4 and a molecular weight of 401.45 g/mol. Its IUPAC name is cobalt(2+);bis(2-ethyl-2,5-dimethylhexanoate).
| Compound Name | cobalt(2+);bis(2-ethyl-2,5-dimethylhexanoate) |
|---|---|
| PubChem CID | 22833328 |
| Molecular Formula | C20H38CoO4 |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | cobalt(2+);bis(2-ethyl-2,5-dimethylhexanoate) |
| SMILES | CCC(C)(CCC(C)C)C(=O)[O-].CCC(C)(CCC(C)C)C(=O)[O-].[Co+2] |
| InChI | InChI=1S/2C10H20O2.Co/c2*1-5-10(4,9(11)12)7-6-8(2)3;/h2*8H,5-7H2,1-4H3,(H,11,12);/q;;+2/p-2 |
| InChIKey | KOKXAPDKXDSOEG-UHFFFAOYSA-L |
| XLogP | 3.18 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |