C13H26O4 — CID 151891886
2,3-dihydroxypropyl 2-ethyl-2,5-dimethylhexanoate (PubChem CID 151891886) has the molecular formula C13H26O4 and a molecular weight of 246.35 g/mol. Its IUPAC name is 2,3-dihydroxypropyl 2-ethyl-2,5-dimethylhexanoate.
| Compound Name | 2,3-dihydroxypropyl 2-ethyl-2,5-dimethylhexanoate |
|---|---|
| PubChem CID | 151891886 |
| Molecular Formula | C13H26O4 |
| Molecular Weight | 246.35 g/mol |
| Exact Mass | 246.18 |
| IUPAC Name | 2,3-dihydroxypropyl 2-ethyl-2,5-dimethylhexanoate |
| SMILES | CCC(C)(CCC(C)C)C(=O)OCC(O)CO |
| InChI | InChI=1S/C13H26O4/c1-5-13(4,7-6-10(2)3)12(16)17-9-11(15)8-14/h10-11,14-15H,5-9H2,1-4H3 |
| InChIKey | SQXDPFIPTNAVQR-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.35 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |