C11H8Cl2OS — CID 166927499
2-(2,6-dichloro-4-methoxyphenyl)thiophene (PubChem CID 166927499) has the molecular formula C11H8Cl2OS and a molecular weight of 259.16 g/mol. Its IUPAC name is 2-(2,6-dichloro-4-methoxyphenyl)thiophene.
| Compound Name | 2-(2,6-dichloro-4-methoxyphenyl)thiophene |
|---|---|
| PubChem CID | 166927499 |
| Molecular Formula | C11H8Cl2OS |
| Molecular Weight | 259.16 g/mol |
| Exact Mass | 257.97 |
| IUPAC Name | 2-(2,6-dichloro-4-methoxyphenyl)thiophene |
| SMILES | COc1cc(Cl)c(-c2cccs2)c(Cl)c1 |
| InChI | InChI=1S/C11H8Cl2OS/c1-14-7-5-8(12)11(9(13)6-7)10-3-2-4-15-10/h2-6H,1H3 |
| InChIKey | NVYHFIDGGBGANT-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.16 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |