C21H18O3S2 — CID 102473050
1-thiophen-2-yl-3-(2,4,6-trimethoxyphenyl)-2-benzothiophene (PubChem CID 102473050) has the molecular formula C21H18O3S2 and a molecular weight of 382.51 g/mol. Its IUPAC name is 1-thiophen-2-yl-3-(2,4,6-trimethoxyphenyl)-2-benzothiophene.
| Compound Name | 1-thiophen-2-yl-3-(2,4,6-trimethoxyphenyl)-2-benzothiophene |
|---|---|
| PubChem CID | 102473050 |
| Molecular Formula | C21H18O3S2 |
| Molecular Weight | 382.51 g/mol |
| Exact Mass | 382.07 |
| IUPAC Name | 1-thiophen-2-yl-3-(2,4,6-trimethoxyphenyl)-2-benzothiophene |
| SMILES | COc1cc(OC)c(-c2sc(-c3cccs3)c3ccccc23)c(OC)c1 |
| InChI | InChI=1S/C21H18O3S2/c1-22-13-11-16(23-2)19(17(12-13)24-3)21-15-8-5-4-7-14(15)20(26-21)18-9-6-10-25-18/h4-12H,1-3H3 |
| InChIKey | BJIBRUPSSBJASK-UHFFFAOYSA-N |
| XLogP | 6.32 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |