C28H32N4O5 — CID 166930643
1-[(5R)-2,4-dioxo-3-[2-oxo-2-(3-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethyl]spiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea (PubChem CID 166930643) has the molecular formula C28H32N4O5 and a molecular weight of 504.59 g/mol. Its IUPAC name is 1-[(5R)-2,4-dioxo-3-[2-oxo-2-(3-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethyl]spiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea.
| Compound Name | 1-[(5R)-2,4-dioxo-3-[2-oxo-2-(3-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethyl]spiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
|---|---|
| PubChem CID | 166930643 |
| Molecular Formula | C28H32N4O5 |
| Molecular Weight | 504.59 g/mol |
| Exact Mass | 504.24 |
| IUPAC Name | 1-[(5R)-2,4-dioxo-3-[2-oxo-2-(3-propan-2-yl-1,3,4,5-tetrahydro-2-benzazepin-2-yl)ethyl]spiro[1,3-oxazolidine-5,1'-2,3-dihydroindene]-5'-yl]-3-methylurea |
| SMILES | CNC(=O)Nc1ccc2c(c1)CC[C@@]21OC(=O)N(CC(=O)N2Cc3ccccc3CCC2C(C)C)C1=O |
| InChI | InChI=1S/C28H32N4O5/c1-17(2)23-11-8-18-6-4-5-7-20(18)15-31(23)24(33)16-32-25(34)28(37-27(32)36)13-12-19-14-21(9-10-22(19)28)30-26(35)29-3/h4-7,9-10,14,17,23H,8,11-13,15-16H2,1-3H3,(H2,29,30,35)/t23?,28-/m1/s1 |
| InChIKey | DWEARXWGIZTRSX-GBAZGAGXSA-N |
| XLogP | 3.56 |
| TPSA | 108.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.59 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |