C32H36N4 — CID 166932594
4-[1-(3-methylbut-3-enylamino)ethenyl]-N-[2-methyl-1-[4-(5-phenyl-4H-pyrazol-3-yl)phenyl]propyl]aniline (PubChem CID 166932594) has the molecular formula C32H36N4 and a molecular weight of 476.67 g/mol. Its IUPAC name is 4-[1-(3-methylbut-3-enylamino)ethenyl]-N-[2-methyl-1-[4-(5-phenyl-4H-pyrazol-3-yl)phenyl]propyl]aniline.
| Compound Name | 4-[1-(3-methylbut-3-enylamino)ethenyl]-N-[2-methyl-1-[4-(5-phenyl-4H-pyrazol-3-yl)phenyl]propyl]aniline |
|---|---|
| PubChem CID | 166932594 |
| Molecular Formula | C32H36N4 |
| Molecular Weight | 476.67 g/mol |
| Exact Mass | 476.29 |
| IUPAC Name | 4-[1-(3-methylbut-3-enylamino)ethenyl]-N-[2-methyl-1-[4-(5-phenyl-4H-pyrazol-3-yl)phenyl]propyl]aniline |
| SMILES | C=C(C)CCNC(=C)c1ccc(NC(c2ccc(C3=NN=C(c4ccccc4)C3)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C32H36N4/c1-22(2)19-20-33-24(5)25-15-17-29(18-16-25)34-32(23(3)4)28-13-11-27(12-14-28)31-21-30(35-36-31)26-9-7-6-8-10-26/h6-18,23,32-34H,1,5,19-21H2,2-4H3 |
| InChIKey | VNKGXTVNTVYPHK-UHFFFAOYSA-N |
| XLogP | 7.62 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.67 |
| LogP ≤ 5 | 7.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|