C31H36N4 — CID 166932519
N-[1-[4-(2-phenyl-4H-imidazol-5-yl)phenyl]pentyl]-4-[1-(propylamino)ethenyl]aniline (PubChem CID 166932519) has the molecular formula C31H36N4 and a molecular weight of 464.66 g/mol. Its IUPAC name is N-[1-[4-(2-phenyl-4H-imidazol-5-yl)phenyl]pentyl]-4-[1-(propylamino)ethenyl]aniline.
| Compound Name | N-[1-[4-(2-phenyl-4H-imidazol-5-yl)phenyl]pentyl]-4-[1-(propylamino)ethenyl]aniline |
|---|---|
| PubChem CID | 166932519 |
| Molecular Formula | C31H36N4 |
| Molecular Weight | 464.66 g/mol |
| Exact Mass | 464.29 |
| IUPAC Name | N-[1-[4-(2-phenyl-4H-imidazol-5-yl)phenyl]pentyl]-4-[1-(propylamino)ethenyl]aniline |
| SMILES | C=C(NCCC)c1ccc(NC(CCCC)c2ccc(C3=NC(c4ccccc4)=NC3)cc2)cc1 |
| InChI | InChI=1S/C31H36N4/c1-4-6-12-29(34-28-19-17-24(18-20-28)23(3)32-21-5-2)25-13-15-26(16-14-25)30-22-33-31(35-30)27-10-8-7-9-11-27/h7-11,13-20,29,32,34H,3-6,12,21-22H2,1-2H3 |
| InChIKey | ROFANBALNXRASZ-UHFFFAOYSA-N |
| XLogP | 7.25 |
| TPSA | 48.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.66 |
| LogP ≤ 5 | 7.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |