C10H16O4 — CID 166933113
(2R,6S)-2-[(1S)-1,2-dihydroxyethyl]-6-prop-2-enyloxan-3-one (PubChem CID 166933113) has the molecular formula C10H16O4 and a molecular weight of 200.23 g/mol. Its IUPAC name is (2R,6S)-2-[(1S)-1,2-dihydroxyethyl]-6-prop-2-enyloxan-3-one.
| Compound Name | (2R,6S)-2-[(1S)-1,2-dihydroxyethyl]-6-prop-2-enyloxan-3-one |
|---|---|
| PubChem CID | 166933113 |
| Molecular Formula | C10H16O4 |
| Molecular Weight | 200.23 g/mol |
| Exact Mass | 200.10 |
| IUPAC Name | (2R,6S)-2-[(1S)-1,2-dihydroxyethyl]-6-prop-2-enyloxan-3-one |
| SMILES | C=CC[C@@H]1CCC(=O)[C@@H]([C@@H](O)CO)O1 |
| InChI | InChI=1S/C10H16O4/c1-2-3-7-4-5-8(12)10(14-7)9(13)6-11/h2,7,9-11,13H,1,3-6H2/t7-,9+,10+/m1/s1 |
| InChIKey | JIBMGIYDXSLOKN-JEZHCXPESA-N |
| XLogP | 0.03 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.23 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|