C14H15N5 — CID 166936156
3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)bicyclo[2.2.0]hexan-1-amine (PubChem CID 166936156) has the molecular formula C14H15N5 and a molecular weight of 253.31 g/mol. Its IUPAC name is 3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)bicyclo[2.2.0]hexan-1-amine.
| Compound Name | 3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)bicyclo[2.2.0]hexan-1-amine |
|---|---|
| PubChem CID | 166936156 |
| Molecular Formula | C14H15N5 |
| Molecular Weight | 253.31 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | 3-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)bicyclo[2.2.0]hexan-1-amine |
| SMILES | NC12CCC1C(n1cnc3cnc4[nH]ccc4c31)C2 |
| InChI | InChI=1S/C14H15N5/c15-14-3-1-9(14)11(5-14)19-7-18-10-6-17-13-8(12(10)19)2-4-16-13/h2,4,6-7,9,11H,1,3,5,15H2,(H,16,17) |
| InChIKey | WOVUVFABACSMRQ-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 72.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.31 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |