C18H20N6O — CID 58395244
2-[3-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]oxetan-3-yl]acetonitrile (PubChem CID 58395244) has the molecular formula C18H20N6O and a molecular weight of 336.40 g/mol. Its IUPAC name is 2-[3-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]oxetan-3-yl]acetonitrile.
| Compound Name | 2-[3-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]oxetan-3-yl]acetonitrile |
|---|---|
| PubChem CID | 58395244 |
| Molecular Formula | C18H20N6O |
| Molecular Weight | 336.40 g/mol |
| Exact Mass | 336.17 |
| IUPAC Name | 2-[3-[4-(3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl)piperidin-1-yl]oxetan-3-yl]acetonitrile |
| SMILES | N#CCC1(N2CCC(n3cnc4cnc5[nH]ccc5c43)CC2)COC1 |
| InChI | InChI=1S/C18H20N6O/c19-5-4-18(10-25-11-18)23-7-2-13(3-8-23)24-12-22-15-9-21-17-14(16(15)24)1-6-20-17/h1,6,9,12-13H,2-4,7-8,10-11H2,(H,20,21) |
| InChIKey | SRPCUVJGZHLXKC-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 82.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.40 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |