C30H39F2N5O6 — CID 166936389
(2S,4R)-4-(1,1-difluoropropyl)-N-[(2S)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(propan-2-ylamino)butan-2-yl]-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 166936389) has the molecular formula C30H39F2N5O6 and a molecular weight of 603.67 g/mol. Its IUPAC name is (2S,4R)-4-(1,1-difluoropropyl)-N-[(2S)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(propan-2-ylamino)butan-2-yl]-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | (2S,4R)-4-(1,1-difluoropropyl)-N-[(2S)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(propan-2-ylamino)butan-2-yl]-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 166936389 |
| Molecular Formula | C30H39F2N5O6 |
| Molecular Weight | 603.67 g/mol |
| Exact Mass | 603.29 |
| IUPAC Name | (2S,4R)-4-(1,1-difluoropropyl)-N-[(2S)-3,4-dioxo-1-[(3S)-2-oxopiperidin-3-yl]-4-(propan-2-ylamino)butan-2-yl]-1-(4-methoxy-1H-indole-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | CCC(F)(F)[C@@H]1C[C@@H](C(=O)N[C@@H](C[C@@H]2CCCNC2=O)C(=O)C(=O)NC(C)C)N(C(=O)c2cc3c(OC)cccc3[nH]2)C1 |
| InChI | InChI=1S/C30H39F2N5O6/c1-5-30(31,32)18-13-23(37(15-18)29(42)22-14-19-20(35-22)9-6-10-24(19)43-4)27(40)36-21(25(38)28(41)34-16(2)3)12-17-8-7-11-33-26(17)39/h6,9-10,14,16-18,21,23,35H,5,7-8,11-13,15H2,1-4H3,(H,33,39)(H,34,41)(H,36,40)/t17-,18+,21-,23-/m0/s1 |
| InChIKey | UAUVNGPDWJEHCK-OXHIVJRSSA-N |
| XLogP | 2.55 |
| TPSA | 149.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.67 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|