C28H34N4O6 — CID 166936861
(3S,3aS,6aR)-N-[(3S)-1-hydroxy-2-oxo-5-[(3S)-2-oxopiperidin-3-yl]pentan-3-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxamide (PubChem CID 166936861) has the molecular formula C28H34N4O6 and a molecular weight of 522.60 g/mol. Its IUPAC name is (3S,3aS,6aR)-N-[(3S)-1-hydroxy-2-oxo-5-[(3S)-2-oxopiperidin-3-yl]pentan-3-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxamide.
| Compound Name | (3S,3aS,6aR)-N-[(3S)-1-hydroxy-2-oxo-5-[(3S)-2-oxopiperidin-3-yl]pentan-3-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
|---|---|
| PubChem CID | 166936861 |
| Molecular Formula | C28H34N4O6 |
| Molecular Weight | 522.60 g/mol |
| Exact Mass | 522.25 |
| IUPAC Name | (3S,3aS,6aR)-N-[(3S)-1-hydroxy-2-oxo-5-[(3S)-2-oxopiperidin-3-yl]pentan-3-yl]-2-(4-methoxy-1H-indole-2-carbonyl)-3,3a,6,6a-tetrahydro-1H-cyclopenta[c]pyrrole-3-carboxamide |
| SMILES | COc1cccc2[nH]c(C(=O)N3C[C@@H]4CC=C[C@@H]4[C@H]3C(=O)N[C@@H](CC[C@@H]3CCCNC3=O)C(=O)CO)cc12 |
| InChI | InChI=1S/C28H34N4O6/c1-38-24-9-3-8-20-19(24)13-22(30-20)28(37)32-14-17-5-2-7-18(17)25(32)27(36)31-21(23(34)15-33)11-10-16-6-4-12-29-26(16)35/h2-3,7-9,13,16-18,21,25,30,33H,4-6,10-12,14-15H2,1H3,(H,29,35)(H,31,36)/t16-,17-,18-,21-,25-/m0/s1 |
| InChIKey | MHOFRESKGVFGQT-TXQBVOROSA-N |
| XLogP | 1.55 |
| TPSA | 140.83 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.60 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|