C25H34N2O8S — CID 166937441
(2R,3S,4R,6R)-3,4,5,6-tetrahydroxy-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-phenylmethoxyheptan-1-one (PubChem CID 166937441) has the molecular formula C25H34N2O8S and a molecular weight of 522.62 g/mol. Its IUPAC name is (2R,3S,4R,6R)-3,4,5,6-tetrahydroxy-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-phenylmethoxyheptan-1-one.
| Compound Name | (2R,3S,4R,6R)-3,4,5,6-tetrahydroxy-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-phenylmethoxyheptan-1-one |
|---|---|
| PubChem CID | 166937441 |
| Molecular Formula | C25H34N2O8S |
| Molecular Weight | 522.62 g/mol |
| Exact Mass | 522.20 |
| IUPAC Name | (2R,3S,4R,6R)-3,4,5,6-tetrahydroxy-1-[4-(4-methylphenyl)sulfonylpiperazin-1-yl]-2-phenylmethoxyheptan-1-one |
| SMILES | Cc1ccc(S(=O)(=O)N2CCN(C(=O)[C@H](OCc3ccccc3)[C@@H](O)[C@H](O)C(O)[C@@H](C)O)CC2)cc1 |
| InChI | InChI=1S/C25H34N2O8S/c1-17-8-10-20(11-9-17)36(33,34)27-14-12-26(13-15-27)25(32)24(23(31)22(30)21(29)18(2)28)35-16-19-6-4-3-5-7-19/h3-11,18,21-24,28-31H,12-16H2,1-2H3/t18-,21?,22-,23+,24-/m1/s1 |
| InChIKey | RIOVPGMGGWNSIX-CTSMQSTOSA-N |
| XLogP | -0.12 |
| TPSA | 147.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.62 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |