C14H23N5O — CID 166944001
N-ethylidene-N'-[(E)-1-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-ylidene]amino]prop-1-en-2-yl]methanimidamide (PubChem CID 166944001) has the molecular formula C14H23N5O and a molecular weight of 277.37 g/mol. Its IUPAC name is N-ethylidene-N'-[(E)-1-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-ylidene]amino]prop-1-en-2-yl]methanimidamide.
| Compound Name | N-ethylidene-N'-[(E)-1-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-ylidene]amino]prop-1-en-2-yl]methanimidamide |
|---|---|
| PubChem CID | 166944001 |
| Molecular Formula | C14H23N5O |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.19 |
| IUPAC Name | N-ethylidene-N'-[(E)-1-[[1-(4-methylpiperazin-1-yl)-1-oxopropan-2-ylidene]amino]prop-1-en-2-yl]methanimidamide |
| SMILES | C/C=N/C=N/C(C)=C/N=C(\C)C(=O)N1CCN(C)CC1 |
| InChI | InChI=1S/C14H23N5O/c1-5-15-11-17-12(2)10-16-13(3)14(20)19-8-6-18(4)7-9-19/h5,10-11H,6-9H2,1-4H3/b12-10+,15-5+,16-13+,17-11+ |
| InChIKey | BXOQHJIFRYVBMP-LAGRTYNISA-N |
| XLogP | 1.20 |
| TPSA | 60.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|