C22H31N5O2 — CID 166944076
N-(3-hydroxypropyl)-2-[4-methyl-6-[4-methyl-2-(2-methylpropyl)anilino]pyrimidin-5-yl]iminopropanamide (PubChem CID 166944076) has the molecular formula C22H31N5O2 and a molecular weight of 397.52 g/mol. Its IUPAC name is N-(3-hydroxypropyl)-2-[4-methyl-6-[4-methyl-2-(2-methylpropyl)anilino]pyrimidin-5-yl]iminopropanamide.
| Compound Name | N-(3-hydroxypropyl)-2-[4-methyl-6-[4-methyl-2-(2-methylpropyl)anilino]pyrimidin-5-yl]iminopropanamide |
|---|---|
| PubChem CID | 166944076 |
| Molecular Formula | C22H31N5O2 |
| Molecular Weight | 397.52 g/mol |
| Exact Mass | 397.25 |
| IUPAC Name | N-(3-hydroxypropyl)-2-[4-methyl-6-[4-methyl-2-(2-methylpropyl)anilino]pyrimidin-5-yl]iminopropanamide |
| SMILES | C/C(=N\c1c(C)ncnc1Nc1ccc(C)cc1CC(C)C)C(=O)NCCCO |
| InChI | InChI=1S/C22H31N5O2/c1-14(2)11-18-12-15(3)7-8-19(18)27-21-20(16(4)24-13-25-21)26-17(5)22(29)23-9-6-10-28/h7-8,12-14,28H,6,9-11H2,1-5H3,(H,23,29)(H,24,25,27)/b26-17+ |
| InChIKey | NUNDHQFJXVASHN-YZSQISJMSA-N |
| XLogP | 3.63 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.52 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|