C20H27FN6O — CID 166712125
N-[3-(dimethylamino)propyl]-2-[4-(3-fluoro-2-methylanilino)-6-methylpyrimidin-5-yl]iminopropanamide (PubChem CID 166712125) has the molecular formula C20H27FN6O and a molecular weight of 386.48 g/mol. Its IUPAC name is N-[3-(dimethylamino)propyl]-2-[4-(3-fluoro-2-methylanilino)-6-methylpyrimidin-5-yl]iminopropanamide.
| Compound Name | N-[3-(dimethylamino)propyl]-2-[4-(3-fluoro-2-methylanilino)-6-methylpyrimidin-5-yl]iminopropanamide |
|---|---|
| PubChem CID | 166712125 |
| Molecular Formula | C20H27FN6O |
| Molecular Weight | 386.48 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-[3-(dimethylamino)propyl]-2-[4-(3-fluoro-2-methylanilino)-6-methylpyrimidin-5-yl]iminopropanamide |
| SMILES | C/C(=N\c1c(C)ncnc1Nc1cccc(F)c1C)C(=O)NCCCN(C)C |
| InChI | InChI=1S/C20H27FN6O/c1-13-16(21)8-6-9-17(13)26-19-18(14(2)23-12-24-19)25-15(3)20(28)22-10-7-11-27(4)5/h6,8-9,12H,7,10-11H2,1-5H3,(H,22,28)(H,23,24,26)/b25-15+ |
| InChIKey | OURNYZQTDQABNY-MFKUBSTISA-N |
| XLogP | 3.14 |
| TPSA | 82.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.48 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|