C7H11NS — CID 166944546
S-(4-methylcyclohexa-1,5-dien-1-yl)thiohydroxylamine (PubChem CID 166944546) has the molecular formula C7H11NS and a molecular weight of 141.24 g/mol. Its IUPAC name is S-(4-methylcyclohexa-1,5-dien-1-yl)thiohydroxylamine.
| Compound Name | S-(4-methylcyclohexa-1,5-dien-1-yl)thiohydroxylamine |
|---|---|
| PubChem CID | 166944546 |
| Molecular Formula | C7H11NS |
| Molecular Weight | 141.24 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | S-(4-methylcyclohexa-1,5-dien-1-yl)thiohydroxylamine |
| SMILES | CC1C=CC(SN)=CC1 |
| InChI | InChI=1S/C7H11NS/c1-6-2-4-7(9-8)5-3-6/h2,4-6H,3,8H2,1H3 |
| InChIKey | OIYBPZCQWSKFRL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 141.24 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|