C16H21N3O2 — CID 166944968
N-[(3E)-3-aminohexa-1,3-dien-2-yl]-5-(hydroxymethyl)-1,3-dihydroisoindole-2-carboxamide (PubChem CID 166944968) has the molecular formula C16H21N3O2 and a molecular weight of 287.36 g/mol. Its IUPAC name is N-[(3E)-3-aminohexa-1,3-dien-2-yl]-5-(hydroxymethyl)-1,3-dihydroisoindole-2-carboxamide.
| Compound Name | N-[(3E)-3-aminohexa-1,3-dien-2-yl]-5-(hydroxymethyl)-1,3-dihydroisoindole-2-carboxamide |
|---|---|
| PubChem CID | 166944968 |
| Molecular Formula | C16H21N3O2 |
| Molecular Weight | 287.36 g/mol |
| Exact Mass | 287.16 |
| IUPAC Name | N-[(3E)-3-aminohexa-1,3-dien-2-yl]-5-(hydroxymethyl)-1,3-dihydroisoindole-2-carboxamide |
| SMILES | C=C(NC(=O)N1Cc2ccc(CO)cc2C1)/C(N)=C\CC |
| InChI | InChI=1S/C16H21N3O2/c1-3-4-15(17)11(2)18-16(21)19-8-13-6-5-12(10-20)7-14(13)9-19/h4-7,20H,2-3,8-10,17H2,1H3,(H,18,21)/b15-4+ |
| InChIKey | JCPXCPGOKYZXRD-SYZQJQIISA-N |
| XLogP | 1.97 |
| TPSA | 78.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.36 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|