C14H15N3O4 — CID 166956303
ethyl 12-methoxy-7-oxo-2,3,8-triazatricyclo[7.4.0.02,5]trideca-1(9),4,10,12-tetraene-4-carboxylate (PubChem CID 166956303) has the molecular formula C14H15N3O4 and a molecular weight of 289.29 g/mol. Its IUPAC name is ethyl 12-methoxy-7-oxo-2,3,8-triazatricyclo[7.4.0.02,5]trideca-1(9),4,10,12-tetraene-4-carboxylate.
| Compound Name | ethyl 12-methoxy-7-oxo-2,3,8-triazatricyclo[7.4.0.02,5]trideca-1(9),4,10,12-tetraene-4-carboxylate |
|---|---|
| PubChem CID | 166956303 |
| Molecular Formula | C14H15N3O4 |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 289.11 |
| IUPAC Name | ethyl 12-methoxy-7-oxo-2,3,8-triazatricyclo[7.4.0.02,5]trideca-1(9),4,10,12-tetraene-4-carboxylate |
| SMILES | CCOC(=O)c1[nH]n2c1CC(=O)Nc1ccc(OC)cc1-2 |
| InChI | InChI=1S/C14H15N3O4/c1-3-21-14(19)13-11-7-12(18)15-9-5-4-8(20-2)6-10(9)17(11)16-13/h4-6,16H,3,7H2,1-2H3,(H,15,18) |
| InChIKey | SORIENPGJAZKQZ-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |