C20H19F3N4O4 — CID 166959932
2,2,2-trifluoro-N-(11-hydroxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-dien-4-yl)acetamide (PubChem CID 166959932) has the molecular formula C20H19F3N4O4 and a molecular weight of 436.39 g/mol. Its IUPAC name is 2,2,2-trifluoro-N-(11-hydroxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-dien-4-yl)acetamide.
| Compound Name | 2,2,2-trifluoro-N-(11-hydroxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-dien-4-yl)acetamide |
|---|---|
| PubChem CID | 166959932 |
| Molecular Formula | C20H19F3N4O4 |
| Molecular Weight | 436.39 g/mol |
| Exact Mass | 436.14 |
| IUPAC Name | 2,2,2-trifluoro-N-(11-hydroxy-8-methyl-9,12-dioxo-3-phenyl-1,2,8-triazatricyclo[8.4.0.02,7]tetradeca-10,13-dien-4-yl)acetamide |
| SMILES | CN1C(=O)c2c(O)c(=O)ccn2N2C(c3ccccc3)C(NC(=O)C(F)(F)F)CCC12 |
| InChI | InChI=1S/C20H19F3N4O4/c1-25-14-8-7-12(24-19(31)20(21,22)23)15(11-5-3-2-4-6-11)27(14)26-10-9-13(28)17(29)16(26)18(25)30/h2-6,9-10,12,14-15,29H,7-8H2,1H3,(H,24,31) |
| InChIKey | YGNWFAWYBQNJQT-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 94.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.39 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |