C26H25N3O5 — CID 166959950
(3R)-6-[(7-hydroxy-5,6,7,8-tetrahydro-1,8-naphthyridin-4-yl)oxy]-N-phenacyl-3,4-dihydro-2H-chromene-3-carboxamide (PubChem CID 166959950) has the molecular formula C26H25N3O5 and a molecular weight of 459.50 g/mol. Its IUPAC name is (3R)-6-[(7-hydroxy-5,6,7,8-tetrahydro-1,8-naphthyridin-4-yl)oxy]-N-phenacyl-3,4-dihydro-2H-chromene-3-carboxamide.
| Compound Name | (3R)-6-[(7-hydroxy-5,6,7,8-tetrahydro-1,8-naphthyridin-4-yl)oxy]-N-phenacyl-3,4-dihydro-2H-chromene-3-carboxamide |
|---|---|
| PubChem CID | 166959950 |
| Molecular Formula | C26H25N3O5 |
| Molecular Weight | 459.50 g/mol |
| Exact Mass | 459.18 |
| IUPAC Name | (3R)-6-[(7-hydroxy-5,6,7,8-tetrahydro-1,8-naphthyridin-4-yl)oxy]-N-phenacyl-3,4-dihydro-2H-chromene-3-carboxamide |
| SMILES | O=C(CNC(=O)[C@H]1COc2ccc(Oc3ccnc4c3CCC(O)N4)cc2C1)c1ccccc1 |
| InChI | InChI=1S/C26H25N3O5/c30-21(16-4-2-1-3-5-16)14-28-26(32)18-12-17-13-19(6-8-22(17)33-15-18)34-23-10-11-27-25-20(23)7-9-24(31)29-25/h1-6,8,10-11,13,18,24,31H,7,9,12,14-15H2,(H,27,29)(H,28,32)/t18-,24?/m1/s1 |
| InChIKey | USVPKRTYLYPNMQ-QFADGXAASA-N |
| XLogP | 3.10 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.50 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |