C22H26FNO2 — CID 166960776
N-[(5,5-dimethyloxolan-3-yl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide (PubChem CID 166960776) has the molecular formula C22H26FNO2 and a molecular weight of 355.45 g/mol. Its IUPAC name is N-[(5,5-dimethyloxolan-3-yl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide.
| Compound Name | N-[(5,5-dimethyloxolan-3-yl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide |
|---|---|
| PubChem CID | 166960776 |
| Molecular Formula | C22H26FNO2 |
| Molecular Weight | 355.45 g/mol |
| Exact Mass | 355.19 |
| IUPAC Name | N-[(5,5-dimethyloxolan-3-yl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide |
| SMILES | CC1(C)CC(CNC(=O)c2ccc(C#CC3=CCCCC3F)cc2)CO1 |
| InChI | InChI=1S/C22H26FNO2/c1-22(2)13-17(15-26-22)14-24-21(25)19-11-8-16(9-12-19)7-10-18-5-3-4-6-20(18)23/h5,8-9,11-12,17,20H,3-4,6,13-15H2,1-2H3,(H,24,25) |
| InChIKey | LYKFGKFIQJFGQC-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|