C21H22F3NO — CID 166960587
N-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide (PubChem CID 166960587) has the molecular formula C21H22F3NO and a molecular weight of 361.41 g/mol. Its IUPAC name is N-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide.
| Compound Name | N-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide |
|---|---|
| PubChem CID | 166960587 |
| Molecular Formula | C21H22F3NO |
| Molecular Weight | 361.41 g/mol |
| Exact Mass | 361.17 |
| IUPAC Name | N-[(3,3-difluoro-1-methylcyclobutyl)methyl]-4-[2-(6-fluorocyclohexen-1-yl)ethynyl]benzamide |
| SMILES | CC1(CNC(=O)c2ccc(C#CC3=CCCCC3F)cc2)CC(F)(F)C1 |
| InChI | InChI=1S/C21H22F3NO/c1-20(12-21(23,24)13-20)14-25-19(26)17-10-7-15(8-11-17)6-9-16-4-2-3-5-18(16)22/h4,7-8,10-11,18H,2-3,5,12-14H2,1H3,(H,25,26) |
| InChIKey | RLZVNYJTMRNPNY-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.41 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|