C20H20F5N5O — CID 166961583
1,1,1-trifluoro-2-[3-[4-fluoro-6-[[(3S,4S)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]imidazo[1,2-a]pyridin-6-yl]propan-2-ol (PubChem CID 166961583) has the molecular formula C20H20F5N5O and a molecular weight of 441.40 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-[3-[4-fluoro-6-[[(3S,4S)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]imidazo[1,2-a]pyridin-6-yl]propan-2-ol.
| Compound Name | 1,1,1-trifluoro-2-[3-[4-fluoro-6-[[(3S,4S)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]imidazo[1,2-a]pyridin-6-yl]propan-2-ol |
|---|---|
| PubChem CID | 166961583 |
| Molecular Formula | C20H20F5N5O |
| Molecular Weight | 441.40 g/mol |
| Exact Mass | 441.16 |
| IUPAC Name | 1,1,1-trifluoro-2-[3-[4-fluoro-6-[[(3S,4S)-4-fluoropiperidin-3-yl]amino]-2-pyridinyl]imidazo[1,2-a]pyridin-6-yl]propan-2-ol |
| SMILES | CC(O)(c1ccc2ncc(-c3cc(F)cc(N[C@H]4CNCC[C@@H]4F)n3)n2c1)C(F)(F)F |
| InChI | InChI=1S/C20H20F5N5O/c1-19(31,20(23,24)25)11-2-3-18-27-9-16(30(18)10-11)14-6-12(21)7-17(28-14)29-15-8-26-5-4-13(15)22/h2-3,6-7,9-10,13,15,26,31H,4-5,8H2,1H3,(H,28,29)/t13-,15-,19?/m0/s1 |
| InChIKey | SLVIGCRKLKFDQT-MEFJIFBHSA-N |
| XLogP | 3.42 |
| TPSA | 74.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.40 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |