C15H10BrF4N3O — CID 166961903
2-[3-(6-bromo-4-fluoro-2-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,1,1-trifluoropropan-2-ol (PubChem CID 166961903) has the molecular formula C15H10BrF4N3O and a molecular weight of 404.16 g/mol. Its IUPAC name is 2-[3-(6-bromo-4-fluoro-2-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,1,1-trifluoropropan-2-ol.
| Compound Name | 2-[3-(6-bromo-4-fluoro-2-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,1,1-trifluoropropan-2-ol |
|---|---|
| PubChem CID | 166961903 |
| Molecular Formula | C15H10BrF4N3O |
| Molecular Weight | 404.16 g/mol |
| Exact Mass | 402.99 |
| IUPAC Name | 2-[3-(6-bromo-4-fluoro-2-pyridinyl)imidazo[1,2-a]pyridin-6-yl]-1,1,1-trifluoropropan-2-ol |
| SMILES | CC(O)(c1ccc2ncc(-c3cc(F)cc(Br)n3)n2c1)C(F)(F)F |
| InChI | InChI=1S/C15H10BrF4N3O/c1-14(24,15(18,19)20)8-2-3-13-21-6-11(23(13)7-8)10-4-9(17)5-12(16)22-10/h2-7,24H,1H3 |
| InChIKey | VRZAJZJDYODWFQ-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 50.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.16 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|