C23H24F4N4O3S — CID 166963054
1-[5-(2-hexoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea (PubChem CID 166963054) has the molecular formula C23H24F4N4O3S and a molecular weight of 512.53 g/mol. Its IUPAC name is 1-[5-(2-hexoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea.
| Compound Name | 1-[5-(2-hexoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
|---|---|
| PubChem CID | 166963054 |
| Molecular Formula | C23H24F4N4O3S |
| Molecular Weight | 512.53 g/mol |
| Exact Mass | 512.15 |
| IUPAC Name | 1-[5-(2-hexoxyphenyl)-1,3,4-thiadiazol-2-yl]-3-[4-(1,1,2,2-tetrafluoroethoxy)phenyl]urea |
| SMILES | CCCCCCOc1ccccc1-c1nnc(NC(=O)Nc2ccc(OC(F)(F)C(F)F)cc2)s1 |
| InChI | InChI=1S/C23H24F4N4O3S/c1-2-3-4-7-14-33-18-9-6-5-8-17(18)19-30-31-22(35-19)29-21(32)28-15-10-12-16(13-11-15)34-23(26,27)20(24)25/h5-6,8-13,20H,2-4,7,14H2,1H3,(H2,28,29,31,32) |
| InChIKey | NLUDMRBFHGEBGH-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.53 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|