C13H23N — CID 166963520
5-heptan-2-yl-2-methyl-2,3-dihydropyridine (PubChem CID 166963520) has the molecular formula C13H23N and a molecular weight of 193.33 g/mol. Its IUPAC name is 5-heptan-2-yl-2-methyl-2,3-dihydropyridine.
| Compound Name | 5-heptan-2-yl-2-methyl-2,3-dihydropyridine |
|---|---|
| PubChem CID | 166963520 |
| Molecular Formula | C13H23N |
| Molecular Weight | 193.33 g/mol |
| Exact Mass | 193.18 |
| IUPAC Name | 5-heptan-2-yl-2-methyl-2,3-dihydropyridine |
| SMILES | CCCCCC(C)C1=CCC(C)N=C1 |
| InChI | InChI=1S/C13H23N/c1-4-5-6-7-11(2)13-9-8-12(3)14-10-13/h9-12H,4-8H2,1-3H3 |
| InChIKey | NKTFECYRCFFBQD-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.33 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|