C13H23IN2O5 — CID 166964565
N-(2,6-dioxoheptan-3-yl)-2-[2-[2-(iodoamino)ethoxy]ethoxy]acetamide (PubChem CID 166964565) has the molecular formula C13H23IN2O5 and a molecular weight of 414.24 g/mol. Its IUPAC name is N-(2,6-dioxoheptan-3-yl)-2-[2-[2-(iodoamino)ethoxy]ethoxy]acetamide.
| Compound Name | N-(2,6-dioxoheptan-3-yl)-2-[2-[2-(iodoamino)ethoxy]ethoxy]acetamide |
|---|---|
| PubChem CID | 166964565 |
| Molecular Formula | C13H23IN2O5 |
| Molecular Weight | 414.24 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | N-(2,6-dioxoheptan-3-yl)-2-[2-[2-(iodoamino)ethoxy]ethoxy]acetamide |
| SMILES | CC(=O)CCC(NC(=O)COCCOCCNI)C(C)=O |
| InChI | InChI=1S/C13H23IN2O5/c1-10(17)3-4-12(11(2)18)16-13(19)9-21-8-7-20-6-5-15-14/h12,15H,3-9H2,1-2H3,(H,16,19) |
| InChIKey | PQAAHNDZDQAGEQ-UHFFFAOYSA-N |
| XLogP | 0.40 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.24 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|