C12H20I2N2O5 — CID 166964505
4-[[2-[2-[2-(iodoamino)ethoxy]ethoxy]acetyl]amino]-5-oxohexanoyl iodide (PubChem CID 166964505) has the molecular formula C12H20I2N2O5 and a molecular weight of 526.11 g/mol. Its IUPAC name is 4-[[2-[2-[2-(iodoamino)ethoxy]ethoxy]acetyl]amino]-5-oxohexanoyl iodide.
| Compound Name | 4-[[2-[2-[2-(iodoamino)ethoxy]ethoxy]acetyl]amino]-5-oxohexanoyl iodide |
|---|---|
| PubChem CID | 166964505 |
| Molecular Formula | C12H20I2N2O5 |
| Molecular Weight | 526.11 g/mol |
| Exact Mass | 525.95 |
| IUPAC Name | 4-[[2-[2-[2-(iodoamino)ethoxy]ethoxy]acetyl]amino]-5-oxohexanoyl iodide |
| SMILES | CC(=O)C(CCC(=O)I)NC(=O)COCCOCCNI |
| InChI | InChI=1S/C12H20I2N2O5/c1-9(17)10(2-3-11(13)18)16-12(19)8-21-7-6-20-5-4-15-14/h10,15H,2-8H2,1H3,(H,16,19) |
| InChIKey | ONFWZXJXKYSBNT-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.11 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|