C21H40N2O4 — CID 170405058
2-[2-[2-(tert-butylamino)ethoxy]ethoxy]-N-(2,2,7-trimethyl-3-oxooct-7-en-4-yl)acetamide (PubChem CID 170405058) has the molecular formula C21H40N2O4 and a molecular weight of 384.56 g/mol. Its IUPAC name is 2-[2-[2-(tert-butylamino)ethoxy]ethoxy]-N-(2,2,7-trimethyl-3-oxooct-7-en-4-yl)acetamide.
| Compound Name | 2-[2-[2-(tert-butylamino)ethoxy]ethoxy]-N-(2,2,7-trimethyl-3-oxooct-7-en-4-yl)acetamide |
|---|---|
| PubChem CID | 170405058 |
| Molecular Formula | C21H40N2O4 |
| Molecular Weight | 384.56 g/mol |
| Exact Mass | 384.30 |
| IUPAC Name | 2-[2-[2-(tert-butylamino)ethoxy]ethoxy]-N-(2,2,7-trimethyl-3-oxooct-7-en-4-yl)acetamide |
| SMILES | C=C(C)CCC(NC(=O)COCCOCCNC(C)(C)C)C(=O)C(C)(C)C |
| InChI | InChI=1S/C21H40N2O4/c1-16(2)9-10-17(19(25)20(3,4)5)23-18(24)15-27-14-13-26-12-11-22-21(6,7)8/h17,22H,1,9-15H2,2-8H3,(H,23,24) |
| InChIKey | CXQAFMZULMFWFP-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.56 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|