About [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate
[tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate (PubChem CID 16696458) has the molecular formula C33H29N2O4Sb
and a molecular weight of 639.37 g/mol. Its IUPAC name is [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate.
Molecular Properties
| Compound Name | [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate |
| PubChem CID | 16696458 |
| Molecular Formula | C33H29N2O4Sb |
| Molecular Weight | 639.37 g/mol |
| Exact Mass | 638.12 |
| IUPAC Name | [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate |
| SMILES | Cc1ccc([Sb](OC(=O)c2cccnc2)(OC(=O)c2cccnc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/3C7H7.2C6H5NO2.Sb/c3*1-7-5-3-2-4-6-7;2*8-6(9)5-2-1-3-7-4-5;/h3*3-6H,1H3;2*1-4H,(H,8,9);/q;;;;;+2/p-2 |
| InChIKey | BTDHLIWAOVCQKU-UHFFFAOYSA-L |
| XLogP | 4.53 |
| TPSA | 78.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 639.37 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
The IUPAC name of [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate (CID 16696458) is [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate.
What is the SMILES notation for [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
The canonical SMILES for [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate is Cc1ccc([Sb](OC(=O)c2cccnc2)(OC(=O)c2cccnc2)(c2ccc(C)cc2)c2ccc(C)cc2)cc1.
What is the InChIKey of [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
The InChIKey is BTDHLIWAOVCQKU-UHFFFAOYSA-L. The full InChI is InChI=1S/3C7H7.2C6H5NO2.Sb/c3*1-7-5-3-2-4-6-7;2*8-6(9)5-2-1-3-7-4-5;/h3*3-6H,1H3;2*1-4H,(H,8,9);/q;;;;;+2/p-2.
What are the key properties of [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate?
[tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate has a molecular weight of 639.37 g/mol, XLogP of 4.53, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [tris(4-methylphenyl)-(pyridine-3-carbonyloxy)-λ5-stibanyl] pyridine-3-carboxylate is sourced from PubChem (CID 16696458), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).